eakinscory72 eakinscory72

13-09-2021
Mathematics

contestada

The length of a rectangle is 3 cm less than twice its width if the perimeter of the rectangle is 18 cm find its dimensions

Respuesta :

muhammadadan1002 muhammadadan1002

13-09-2021

Answer:

let width be x

Step-by-step explanation:

2x-6+3+2x-6+3=18

4x+6=18

4x=18-6

4x=12

x=12/4

x=3

Answer Link

Otras preguntas

Tell which set or sets the number belongs to: natural numbers, whole numbers, integers, rational numbers, irrational numbers, and real numbers. -30 1-irrational

Which statement below is true only for homogeneous catalysts? a. A homogeneous catalyst is a solid substance to which liquid or gaseous reactants will adhere to

cosec(6b+pi/8)=sec(2b-pi/8)

Case is the form a noun or a pronoun takes to show how it is used in a sentence. The three cases are nominative, objective, and possessive. Identify the case of

the cost of a limited edition baseball card increases from $20 to $40. What percent did the price increase by?

According to Ari Wallach, what is short-termism, and why is it a problem? What is “longpath” and why did Wallach develop the concept? Briefly discu

Which of the following is NOT a reason why the British raised taxes on the colonies of North America? Parliament was afraid that France would attempt to reta

Why do reactants require relatively high-energy collisions to form products? a. So that the orientation is correct for bond breaking to occur. b. So that ther

In order to function properly, your body needs> oxygencarbon dioxidenitrogenall of the above

You are making 5 Autumn Classic bouquets for your friends. You have $610 to spend and want 24 flowers for each bouquet. Roses cost $6 each, tulips cost $4 each,